CAS 1153123-20-6 appears in our catalog under these names: 5-N-(4-Fluorophenyl)isoquinoline-5,8-diamine, 95%, 5-N-(4-Fluorophenyl)isoquinoline-5,8-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-N-(4-fluorophenyl)isoquinoline-5,8-diamine (CAS 1153123-20-6) is a chemical compound with the molecular formula C15H12FN3 and a molecular weight of 253.27 g/mol. IUPAC name: 5-N-(4-fluorophenyl)isoquinoline-5,8-diamine. InChIKey: WVTLRMVCVPDQTL-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | 5-N-(4-fluorophenyl)isoquinoline-5,8-diamine |
| InChIKey | WVTLRMVCVPDQTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=C3C=CN=CC3=C(C=C2)N)F |
Computed by PubChem (NCBI)