Products 1153145-52-8

CAS 1153145-52-8 is the registry number for N,N-Dimethyl-2-((tetrahydro-2H-thiopyran-4-yl)amino)acetamide 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

N,N-dimethyl-2-(thian-4-ylamino)acetamide (CAS 1153145-52-8) is a chemical compound with the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. IUPAC name: N,N-dimethyl-2-(thian-4-ylamino)acetamide. InChIKey: OPQLWNSXUYYKPL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18N2OS
Molecular weight202.32 g/mol
IUPAC nameN,N-dimethyl-2-(thian-4-ylamino)acetamide
InChIKeyOPQLWNSXUYYKPL-UHFFFAOYSA-N
SMILESCN(C)C(=O)CNC1CCSCC1

Computed by PubChem (NCBI)