CAS 1153235-04-1 is the registry number for 2-Fluoro-6-(((3-methylthiophen-2-yl)methyl)amino)benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-6-[(3-methylthiophen-2-yl)methylamino]benzonitrile (CAS 1153235-04-1) is a chemical compound with the molecular formula C13H11FN2S and a molecular weight of 246.31 g/mol. IUPAC name: 2-fluoro-6-[(3-methylthiophen-2-yl)methylamino]benzonitrile. InChIKey: KYGAULPNYVINBA-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2S |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | 2-fluoro-6-[(3-methylthiophen-2-yl)methylamino]benzonitrile |
| InChIKey | KYGAULPNYVINBA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)CNC2=C(C(=CC=C2)F)C#N |
Computed by PubChem (NCBI)