Products 1153279-68-5

CAS 1153279-68-5 is the registry number for 4-Fluoro-2-iodo-5-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-fluoro-2-iodo-5-nitrobenzoic acid (CAS 1153279-68-5) is a chemical compound with the molecular formula C7H3FINO4 and a molecular weight of 311.01 g/mol. IUPAC name: 4-fluoro-2-iodo-5-nitrobenzoic acid. InChIKey: UXSGDXKNZKMKKV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3FINO4
Molecular weight311.01 g/mol
IUPAC name4-fluoro-2-iodo-5-nitrobenzoic acid
InChIKeyUXSGDXKNZKMKKV-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1[N+](=O)[O-])F)I)C(=O)O

Computed by PubChem (NCBI)