Products 1153369-70-0
CAS 1153369-70-0 is the registry number for 1-{3-Fluoro-4-(methyl(pyridin-2-ylmethyl)amino)phenyl}ethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3-fluoro-4-[methyl(pyridin-2-ylmethyl)amino]phenyl]ethanol (CAS 1153369-70-0) is a chemical compound with the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. IUPAC name: 1-[3-fluoro-4-[methyl(pyridin-2-ylmethyl)amino]phenyl]ethanol. InChIKey: NLPCBQZPESMTOD-UHFFFAOYSA-N.
| Molecular formula | C15H17FN2O |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 1-[3-fluoro-4-[methyl(pyridin-2-ylmethyl)amino]phenyl]ethanol |
| InChIKey | NLPCBQZPESMTOD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)N(C)CC2=CC=CC=N2)F)O |
Computed by PubChem (NCBI)