Products 115340-67-5

CAS 115340-67-5 is the registry number for (E)-2,4,4-Trichloro-3-formyl-2-butenoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 1mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

(E)-2,4,4-trichloro-3-formylbut-2-enoic acid (CAS 115340-67-5) is a chemical compound with the molecular formula C5H3Cl3O3 and a molecular weight of 217.43 g/mol. IUPAC name: (E)-2,4,4-trichloro-3-formylbut-2-enoic acid. InChIKey: BYYQBAWEAGLGPF-NSCUHMNNSA-N.

Identity
Molecular formulaC5H3Cl3O3
Molecular weight217.43 g/mol
IUPAC name(E)-2,4,4-trichloro-3-formylbut-2-enoic acid
InChIKeyBYYQBAWEAGLGPF-NSCUHMNNSA-N
SMILESC(=O)/C(=C(/C(=O)O)\Cl)/C(Cl)Cl

Computed by PubChem (NCBI)