CAS 115347-68-7 appears in our catalog under these names: 1H,1H,2H,2H-Heptafluoro-3,3-bis(trifluoromethyl)-1-iodohexane, 95%, 4,4,5,5,6,6,6-Heptafluoro-1-iodo-3,3-bis(trifluoromethyl)hexane. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 25g.
1,1,1,2,2,3,3-heptafluoro-6-iodo-4,4-bis(trifluoromethyl)hexane (CAS 115347-68-7) is a chemical compound with the molecular formula C8H4F13I and a molecular weight of 474.00 g/mol. IUPAC name: 1,1,1,2,2,3,3-heptafluoro-6-iodo-4,4-bis(trifluoromethyl)hexane. InChIKey: SHTVHUOLQCOSDS-UHFFFAOYSA-N.
| Molecular formula | C8H4F13I |
|---|---|
| Molecular weight | 474.00 g/mol |
| IUPAC name | 1,1,1,2,2,3,3-heptafluoro-6-iodo-4,4-bis(trifluoromethyl)hexane |
| InChIKey | SHTVHUOLQCOSDS-UHFFFAOYSA-N |
| SMILES | C(CI)C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)