CAS 1153834-53-7 appears in our catalog under these names: 6-Bromo-3-methyl-3,4-dihydro-2H-1-benzothiopyran-4-one, 95%, 6-Bromo-3-methyl-3,4-dihydro-2H-1-benzothiopyran-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
6-bromo-3-methyl-2,3-dihydrothiochromen-4-one (CAS 1153834-53-7) is a chemical compound with the molecular formula C10H9BrOS and a molecular weight of 257.15 g/mol. IUPAC name: 6-bromo-3-methyl-2,3-dihydrothiochromen-4-one. InChIKey: YKNLXTWNCLJRKV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrOS |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 6-bromo-3-methyl-2,3-dihydrothiochromen-4-one |
| InChIKey | YKNLXTWNCLJRKV-UHFFFAOYSA-N |
| SMILES | CC1CSC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)