CAS 1153839-72-5 appears in our catalog under these names: 1-(5-Cyclopropyl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine, 95%, 1-(5-Cyclopropyl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine (CAS 1153839-72-5) is a chemical compound with the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. IUPAC name: 1-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine. InChIKey: OAQOXCSTPHYAOH-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O |
|---|---|
| Molecular weight | 193.25 g/mol |
| IUPAC name | 1-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine |
| InChIKey | OAQOXCSTPHYAOH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=NOC(=N2)C3CC3)N |
Computed by PubChem (NCBI)