CAS 1154160-17-4 is the registry number for Methyl 3-(chlorosulfonyl)-2,6-dimethoxybenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 3-chlorosulfonyl-2,6-dimethoxybenzoate (CAS 1154160-17-4) is a chemical compound with the molecular formula C10H11ClO6S and a molecular weight of 294.71 g/mol. IUPAC name: methyl 3-chlorosulfonyl-2,6-dimethoxybenzoate. InChIKey: DAQPIRCLICQPDP-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO6S |
|---|---|
| Molecular weight | 294.71 g/mol |
| IUPAC name | methyl 3-chlorosulfonyl-2,6-dimethoxybenzoate |
| InChIKey | DAQPIRCLICQPDP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)S(=O)(=O)Cl)OC)C(=O)OC |
Computed by PubChem (NCBI)