Products 1154160-17-4

CAS 1154160-17-4 is the registry number for Methyl 3-(chlorosulfonyl)-2,6-dimethoxybenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Methyl 3-chlorosulfonyl-2,6-dimethoxybenzoate (CAS 1154160-17-4) is a chemical compound with the molecular formula C10H11ClO6S and a molecular weight of 294.71 g/mol. IUPAC name: methyl 3-chlorosulfonyl-2,6-dimethoxybenzoate. InChIKey: DAQPIRCLICQPDP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO6S
Molecular weight294.71 g/mol
IUPAC namemethyl 3-chlorosulfonyl-2,6-dimethoxybenzoate
InChIKeyDAQPIRCLICQPDP-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)S(=O)(=O)Cl)OC)C(=O)OC

Computed by PubChem (NCBI)