CAS 1154206-77-5 appears in our catalog under these names: 3-(2,5-Dichlorophenyl)-1-(4-oxocyclohexyl)urea, 95%, 3-(2,5-Dichlorophenyl)-1-(4-oxocyclohexyl)urea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2,5-dichlorophenyl)-3-(4-oxocyclohexyl)urea (CAS 1154206-77-5) is a chemical compound with the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.16 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)-3-(4-oxocyclohexyl)urea. InChIKey: SAPWKLZQDKMXPH-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N2O2 |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)-3-(4-oxocyclohexyl)urea |
| InChIKey | SAPWKLZQDKMXPH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1NC(=O)NC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)