CAS 1154226-88-6 is the registry number for 6-Bromo-3-methyl-3,4-dihydro-2H-1-benzothiopyran-4-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-3-methyl-3,4-dihydro-2H-thiochromen-4-amine (CAS 1154226-88-6) is a chemical compound with the molecular formula C10H12BrNS and a molecular weight of 258.18 g/mol. IUPAC name: 6-bromo-3-methyl-3,4-dihydro-2H-thiochromen-4-amine. InChIKey: ZHBGUCITSZSMQV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNS |
|---|---|
| Molecular weight | 258.18 g/mol |
| IUPAC name | 6-bromo-3-methyl-3,4-dihydro-2H-thiochromen-4-amine |
| InChIKey | ZHBGUCITSZSMQV-UHFFFAOYSA-N |
| SMILES | CC1CSC2=C(C1N)C=C(C=C2)Br |
Computed by PubChem (NCBI)