CAS 1154258-05-5 appears in our catalog under these names: 1-(4-Iodobenzenesulfonyl)piperidin-4-amine, 95%, 1-(4-Iodobenzenesulfonyl)piperidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-iodophenyl)sulfonylpiperidin-4-amine (CAS 1154258-05-5) is a chemical compound with the molecular formula C11H15IN2O2S and a molecular weight of 366.22 g/mol. IUPAC name: 1-(4-iodophenyl)sulfonylpiperidin-4-amine. InChIKey: SPFBIKWAGVBODP-UHFFFAOYSA-N.
| Molecular formula | C11H15IN2O2S |
|---|---|
| Molecular weight | 366.22 g/mol |
| IUPAC name | 1-(4-iodophenyl)sulfonylpiperidin-4-amine |
| InChIKey | SPFBIKWAGVBODP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)S(=O)(=O)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)