Products 1154279-11-4

CAS 1154279-11-4 is the registry number for Ibandronate Impurity 33. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl 3-[methyl(pentan-2-yl)amino]propanoate (CAS 1154279-11-4) is a chemical compound with the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. IUPAC name: methyl 3-[methyl(pentan-2-yl)amino]propanoate. InChIKey: OFGLEEDDLJQSAU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21NO2
Molecular weight187.28 g/mol
IUPAC namemethyl 3-[methyl(pentan-2-yl)amino]propanoate
InChIKeyOFGLEEDDLJQSAU-UHFFFAOYSA-N
SMILESCCCC(C)N(C)CCC(=O)OC

Computed by PubChem (NCBI)