CAS 1154346-82-3 appears in our catalog under these names: 2-(3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1H-indole, 95%, 2-(3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(2,3-dihydro-1H-indol-2-yl)-3-(4-fluorophenyl)-1,2,4-oxadiazole (CAS 1154346-82-3) is a chemical compound with the molecular formula C16H12FN3O and a molecular weight of 281.28 g/mol. IUPAC name: 5-(2,3-dihydro-1H-indol-2-yl)-3-(4-fluorophenyl)-1,2,4-oxadiazole. InChIKey: KXVAWXNAPOLWGT-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3O |
|---|---|
| Molecular weight | 281.28 g/mol |
| IUPAC name | 5-(2,3-dihydro-1H-indol-2-yl)-3-(4-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | KXVAWXNAPOLWGT-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C21)C3=NC(=NO3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)