CAS 1154361-20-2 appears in our catalog under these names: 3,5-Dimethyl-1-[3-(trifluoromethyl)phenyl]-1h-pyrazole, 95%, 3,5-Dimethyl-1-(3-(trifluoromethyl)phenyl)-1H-pyrazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazole (CAS 1154361-20-2) is a chemical compound with the molecular formula C12H11F3N2 and a molecular weight of 240.22 g/mol. IUPAC name: 3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazole. InChIKey: MMBOCLCFSWWMLT-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | 3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazole |
| InChIKey | MMBOCLCFSWWMLT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=CC(=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)