CAS 1154385-79-1 is the registry number for 3-((1,1-Dioxidothiomorpholino)methyl)-4-fluorobenzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4-fluorobenzonitrile (CAS 1154385-79-1) is a chemical compound with the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. IUPAC name: 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4-fluorobenzonitrile. InChIKey: BAXOPPOIPKGBKW-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O2S |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4-fluorobenzonitrile |
| InChIKey | BAXOPPOIPKGBKW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=C(C=CC(=C2)C#N)F |
Computed by PubChem (NCBI)