CAS 115446-78-1 is the registry number for 2-chloro-2,2-difluoro-1-(4-(trifluoromethoxy)phenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]ethanone (CAS 115446-78-1) is a chemical compound with the molecular formula C9H4ClF5O2 and a molecular weight of 274.57 g/mol. IUPAC name: 2-chloro-2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]ethanone. InChIKey: GTXBNGSCGAEEPL-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF5O2 |
|---|---|
| Molecular weight | 274.57 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | GTXBNGSCGAEEPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)(F)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)