CAS 1154551-68-4 appears in our catalog under these names: 6-Methyl-2-(4-phenylphenyl)pyrimidin-4-ol, 6-Methyl-2-(4-phenylphenyl)pyrimidin-4-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 10g.
4-methyl-2-(4-phenylphenyl)-1H-pyrimidin-6-one (CAS 1154551-68-4) is a chemical compound with the molecular formula C17H14N2O and a molecular weight of 262.30 g/mol. IUPAC name: 4-methyl-2-(4-phenylphenyl)-1H-pyrimidin-6-one. InChIKey: RNGPKFZYDPYZEI-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 4-methyl-2-(4-phenylphenyl)-1H-pyrimidin-6-one |
| InChIKey | RNGPKFZYDPYZEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=N1)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)