CAS 1154600-74-4 appears in our catalog under these names: 3-Chloro-6-(2,6-difluorophenyl)pyridazine, 95%, 3-Chloro-6-(2,6-difluorophenyl)pyridazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-chloro-6-(2,6-difluorophenyl)pyridazine (CAS 1154600-74-4) is a chemical compound with the molecular formula C10H5ClF2N2 and a molecular weight of 226.61 g/mol. IUPAC name: 3-chloro-6-(2,6-difluorophenyl)pyridazine. InChIKey: NYBXZOPGMHOHGL-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF2N2 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 3-chloro-6-(2,6-difluorophenyl)pyridazine |
| InChIKey | NYBXZOPGMHOHGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NN=C(C=C2)Cl)F |
Computed by PubChem (NCBI)