CAS 115464-83-0 appears in our catalog under these names: Benzofuran-7-amine hydrochloride, 98%, 1-Benzofuran-7-amine hydrochloride, 7-Benzofuranamine hydrochloride, 97%, 97%, BENZOFURAN-7-AMINE HCL, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 500mg, 1g.
1-benzofuran-7-amine;hydrochloride (CAS 115464-83-0) is a chemical compound with the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. IUPAC name: 1-benzofuran-7-amine;hydrochloride. InChIKey: BZHBEKCXIYCPPW-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | 1-benzofuran-7-amine;hydrochloride |
| InChIKey | BZHBEKCXIYCPPW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)OC=C2.Cl |
Computed by PubChem (NCBI)