CAS 1154673-58-1 is the registry number for (1-Trifluoromethanesulfonylpiperidin-4-yl)methanamine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
[1-(trifluoromethylsulfonyl)piperidin-4-yl]methanamine (CAS 1154673-58-1) is a chemical compound with the molecular formula C7H13F3N2O2S and a molecular weight of 246.25 g/mol. IUPAC name: [1-(trifluoromethylsulfonyl)piperidin-4-yl]methanamine. InChIKey: RIQXPPXIZFHYMQ-UHFFFAOYSA-N.
| Molecular formula | C7H13F3N2O2S |
|---|---|
| Molecular weight | 246.25 g/mol |
| IUPAC name | [1-(trifluoromethylsulfonyl)piperidin-4-yl]methanamine |
| InChIKey | RIQXPPXIZFHYMQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CN)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)