Products 115473-63-7
CAS 115473-63-7 appears in our catalog under these names: Rupestonic acid/ 98.07% (existing batch purity), Rupestonic acid, rupestonic acid, 99.95% ,, 99.95% ,. Offered by: TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
2-[(5S,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoic acid (CAS 115473-63-7) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: 2-[(5S,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoic acid. InChIKey: ZFHSKBJBODQVBX-UWJYBYFXSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 2-[(5S,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoic acid |
| InChIKey | ZFHSKBJBODQVBX-UWJYBYFXSA-N |
| SMILES | C[C@H]1CC[C@@H](CC2=C(C(=O)C[C@@H]12)C)C(=C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Rupestonic acid