CAS 1154740-95-0 is the registry number for 1,3,2-Dioxaborolane, 2-(1-chloro-2-naphthalenyl)-4,4,5,5-tetramethyl-, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-(1-chloronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1154740-95-0) is a chemical compound with the molecular formula C16H18BClO2 and a molecular weight of 288.6 g/mol. IUPAC name: 2-(1-chloronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JKSLKPMBGAVYQD-UHFFFAOYSA-N.
| Molecular formula | C16H18BClO2 |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | 2-(1-chloronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JKSLKPMBGAVYQD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C3=CC=CC=C3C=C2)Cl |
Computed by PubChem (NCBI)