CAS 1154740-97-2 is the registry number for 6-Chloro-2,3-dihydro-1-benzofuran-3-ol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-chloro-2,3-dihydro-1-benzofuran-3-ol (CAS 1154740-97-2) is a chemical compound with the molecular formula C8H7ClO2 and a molecular weight of 170.59 g/mol. IUPAC name: 6-chloro-2,3-dihydro-1-benzofuran-3-ol. InChIKey: YRIURKJQEFGHJJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO2 |
|---|---|
| Molecular weight | 170.59 g/mol |
| IUPAC name | 6-chloro-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | YRIURKJQEFGHJJ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)