Products 1154752-78-9

CAS 1154752-78-9 is the registry number for 2-Bromo-7-(tert-butyl)-9,9-dimethyl-9H-fluorene, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-bromo-7-tert-butyl-9,9-dimethylfluorene (CAS 1154752-78-9) is a chemical compound with the molecular formula C19H21Br and a molecular weight of 329.3 g/mol. IUPAC name: 2-bromo-7-tert-butyl-9,9-dimethylfluorene. InChIKey: CIJAVRMAFSIMBU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21Br
Molecular weight329.3 g/mol
IUPAC name2-bromo-7-tert-butyl-9,9-dimethylfluorene
InChIKeyCIJAVRMAFSIMBU-UHFFFAOYSA-N
SMILESCC1(C2=C(C=CC(=C2)C(C)(C)C)C3=C1C=C(C=C3)Br)C

Computed by PubChem (NCBI)