Products 1154758-31-2
CAS 1154758-31-2 is the registry number for Rel-(3aR,4S,7R,7aS)-1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl (4-nitrobenzyl) carbonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] (4-nitrophenyl)methyl carbonate (CAS 1154758-31-2) is a chemical compound with the molecular formula C17H14N2O7 and a molecular weight of 358.3 g/mol. IUPAC name: [(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] (4-nitrophenyl)methyl carbonate. InChIKey: JQPBWZAECBQIKQ-WVKUQDAKSA-N.
| Molecular formula | C17H14N2O7 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | [(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] (4-nitrophenyl)methyl carbonate |
| InChIKey | JQPBWZAECBQIKQ-WVKUQDAKSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]3[C@H]2C(=O)N(C3=O)OC(=O)OCC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)