Products 85677-99-2
CAS 85677-99-2 is the registry number for Nimodipine Metabolite 1. Offered by: TRC. Available pack sizes: 50mg.
2-hydroxyethyl 2-methyl-4-(3-nitrophenyl)-5-oxo-7H-furo[3,4-b]pyridine-3-carboxylate (CAS 85677-99-2) is a chemical compound with the molecular formula C17H14N2O7 and a molecular weight of 358.3 g/mol. IUPAC name: 2-hydroxyethyl 2-methyl-4-(3-nitrophenyl)-5-oxo-7H-furo[3,4-b]pyridine-3-carboxylate. InChIKey: IZYXCJVHSFKXPJ-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O7 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2-hydroxyethyl 2-methyl-4-(3-nitrophenyl)-5-oxo-7H-furo[3,4-b]pyridine-3-carboxylate |
| InChIKey | IZYXCJVHSFKXPJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=N1)COC2=O)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCO |
Computed by PubChem (NCBI)