CAS 1154894-63-9 appears in our catalog under these names: 2-((5-Bromopyridin-2-yl)amino)-2-methylpropan-1-ol, 95+%, 2-((5-Bromopyridin-2-yl)amino)-2-methylpropan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[(5-bromo-2-pyridinyl)amino]-2-methylpropan-1-ol (CAS 1154894-63-9) is a chemical compound with the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. IUPAC name: 2-[(5-bromo-2-pyridinyl)amino]-2-methylpropan-1-ol. InChIKey: CESZUUDROCEANH-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2O |
|---|---|
| Molecular weight | 245.12 g/mol |
| IUPAC name | 2-[(5-bromo-2-pyridinyl)amino]-2-methylpropan-1-ol |
| InChIKey | CESZUUDROCEANH-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NC1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)