CAS 1154974-57-8 appears in our catalog under these names: 1,1-Dioxo-1lambda6-thiomorpholine-4-sulfonyl chloride, 95%, 4-​Thiomorpholinesulfon​yl chloride 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g, 0,5g, 50mg.
1,1-dioxo-1,4-thiazinane-4-sulfonyl chloride (CAS 1154974-57-8) is a chemical compound with the molecular formula C4H8ClNO4S2 and a molecular weight of 233.7 g/mol. IUPAC name: 1,1-dioxo-1,4-thiazinane-4-sulfonyl chloride. InChIKey: FUWMAUBXFITUEK-UHFFFAOYSA-N.
| Molecular formula | C4H8ClNO4S2 |
|---|---|
| Molecular weight | 233.7 g/mol |
| IUPAC name | 1,1-dioxo-1,4-thiazinane-4-sulfonyl chloride |
| InChIKey | FUWMAUBXFITUEK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1S(=O)(=O)Cl |
Computed by PubChem (NCBI)