CAS 1155-51-7 appears in our catalog under these names: 4,4'-Dithiobisbenzoic acid, 98%, 4,4'-Dithiobisbenzoic Acid, Technical Grade, 4,4'-Dithiobisbenzoic acid, 4,4'-Dithiobisbenzoic acid 95%, 4,4''-Dithiobis[benzoic acid], 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 2,5g, 25g, 50g, 100mg, 250mg.
4-[(4-carboxyphenyl)disulfanyl]benzoic acid (CAS 1155-51-7) is a chemical compound with the molecular formula C14H10O4S2 and a molecular weight of 306.4 g/mol. IUPAC name: 4-[(4-carboxyphenyl)disulfanyl]benzoic acid. InChIKey: GAMSSMZJKUMFEY-UHFFFAOYSA-N.
| Molecular formula | C14H10O4S2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 4-[(4-carboxyphenyl)disulfanyl]benzoic acid |
| InChIKey | GAMSSMZJKUMFEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)SSC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)