CAS 1155080-47-9 is the registry number for N-(4-Ethylphenyl)-2-hydrazinopyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(4-ethylphenyl)-2-hydrazinylpyridine-3-sulfonamide (CAS 1155080-47-9) is a chemical compound with the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. IUPAC name: N-(4-ethylphenyl)-2-hydrazinylpyridine-3-sulfonamide. InChIKey: CKCAUVGTAGVKBG-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O2S |
|---|---|
| Molecular weight | 292.36 g/mol |
| IUPAC name | N-(4-ethylphenyl)-2-hydrazinylpyridine-3-sulfonamide |
| InChIKey | CKCAUVGTAGVKBG-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)NS(=O)(=O)C2=C(N=CC=C2)NN |
Computed by PubChem (NCBI)