CAS 1155087-61-8 is the registry number for 2-Cyano-N-(1-(thiophen-2-yl)ethyl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-cyano-N-(1-thiophen-2-ylethyl)benzenesulfonamide (CAS 1155087-61-8) is a chemical compound with the molecular formula C13H12N2O2S2 and a molecular weight of 292.4 g/mol. IUPAC name: 2-cyano-N-(1-thiophen-2-ylethyl)benzenesulfonamide. InChIKey: FBYDESPEEODSHM-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2S2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2-cyano-N-(1-thiophen-2-ylethyl)benzenesulfonamide |
| InChIKey | FBYDESPEEODSHM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CS1)NS(=O)(=O)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)