CAS 1155137-33-9 appears in our catalog under these names: 4-{((tert-butoxy)carbonyl)amino}-5-chloro-2-methoxybenzoic acid, 95%, 4-{((tert-Butoxy)carbonyl)amino}-5-chloro-2-methoxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-chloro-2-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1155137-33-9) is a chemical compound with the molecular formula C13H16ClNO5 and a molecular weight of 301.72 g/mol. IUPAC name: 5-chloro-2-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: KSVAZTGIFFIBGH-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO5 |
|---|---|
| Molecular weight | 301.72 g/mol |
| IUPAC name | 5-chloro-2-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | KSVAZTGIFFIBGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C(=C1)OC)C(=O)O)Cl |
Computed by PubChem (NCBI)