Products 1155159-65-1

CAS 1155159-65-1 is the registry number for 2-(4-(4-Bromo-2-fluorobenzyl)piperazin-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-[(4-bromo-2-fluorophenyl)methyl]piperazin-1-yl]acetic acid (CAS 1155159-65-1) is a chemical compound with the molecular formula C13H16BrFN2O2 and a molecular weight of 331.18 g/mol. IUPAC name: 2-[4-[(4-bromo-2-fluorophenyl)methyl]piperazin-1-yl]acetic acid. InChIKey: RMSMDGRIXFINEU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16BrFN2O2
Molecular weight331.18 g/mol
IUPAC name2-[4-[(4-bromo-2-fluorophenyl)methyl]piperazin-1-yl]acetic acid
InChIKeyRMSMDGRIXFINEU-UHFFFAOYSA-N
SMILESC1CN(CCN1CC2=C(C=C(C=C2)Br)F)CC(=O)O

Computed by PubChem (NCBI)