CAS 115534-33-3 appears in our catalog under these names: TMA-DPH, TMA-DPH/ 98%, TMA–DPH, TMA-DPH 98%, N,N,N-TRIMETHYL-4-(6-PHENYL-1,3,5-HEXAT&. Offered by: Chemat Brand, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 1mg, 10mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
4-methylbenzenesulfonate;trimethyl-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]azanium (CAS 115534-33-3) is a chemical compound with the molecular formula C28H31NO3S and a molecular weight of 461.6 g/mol. IUPAC name: 4-methylbenzenesulfonate;trimethyl-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]azanium. InChIKey: ZKARERKEBVSZCX-VMDDUYISSA-M.
| Molecular formula | C28H31NO3S |
|---|---|
| Molecular weight | 461.6 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;trimethyl-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]azanium |
| InChIKey | ZKARERKEBVSZCX-VMDDUYISSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)C1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)