CAS 1155505-13-7 appears in our catalog under these names: 2-(2-(2-Chlorobenzenesulfonamido)acetamido)acetic acid, 95%, 2-(2-(2-Chlorobenzenesulfonamido)acetamido)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[[2-[(2-chlorophenyl)sulfonylamino]acetyl]amino]acetic acid (CAS 1155505-13-7) is a chemical compound with the molecular formula C10H11ClN2O5S and a molecular weight of 306.72 g/mol. IUPAC name: 2-[[2-[(2-chlorophenyl)sulfonylamino]acetyl]amino]acetic acid. InChIKey: GTVDPIKIVABTDY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O5S |
|---|---|
| Molecular weight | 306.72 g/mol |
| IUPAC name | 2-[[2-[(2-chlorophenyl)sulfonylamino]acetyl]amino]acetic acid |
| InChIKey | GTVDPIKIVABTDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)NCC(=O)NCC(=O)O)Cl |
Computed by PubChem (NCBI)