CAS 1155601-12-9 is the registry number for 6-Bromo-8-fluoro-2-(trifluoromethyl)-1,4-dihydroquinolin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-8-fluoro-2-(trifluoromethyl)-1H-quinolin-4-one (CAS 1155601-12-9) is a chemical compound with the molecular formula C10H4BrF4NO and a molecular weight of 310.04 g/mol. IUPAC name: 6-bromo-8-fluoro-2-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: KKZNOSYSHOJMKJ-UHFFFAOYSA-N.
| Molecular formula | C10H4BrF4NO |
|---|---|
| Molecular weight | 310.04 g/mol |
| IUPAC name | 6-bromo-8-fluoro-2-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | KKZNOSYSHOJMKJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C=C(N2)C(F)(F)F)F)Br |
Computed by PubChem (NCBI)