CAS 1155622-41-5 is the registry number for 4-(2-(5-Phenyl-2H-1,2,3,4-tetrazol-2-yl)ethyl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-[2-(5-phenyltetrazol-2-yl)ethyl]aniline (CAS 1155622-41-5) is a chemical compound with the molecular formula C15H15N5 and a molecular weight of 265.31 g/mol. IUPAC name: 4-[2-(5-phenyltetrazol-2-yl)ethyl]aniline. InChIKey: HMALRDVVVWAKDT-UHFFFAOYSA-N.
| Molecular formula | C15H15N5 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 4-[2-(5-phenyltetrazol-2-yl)ethyl]aniline |
| InChIKey | HMALRDVVVWAKDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(N=N2)CCC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)