Products 1155910-33-0

CAS 1155910-33-0 is the registry number for Methyl 2,5-dichloro-3-(chlorosulfonyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 2,5-dichloro-3-chlorosulfonylbenzoate (CAS 1155910-33-0) is a chemical compound with the molecular formula C8H5Cl3O4S and a molecular weight of 303.5 g/mol. IUPAC name: methyl 2,5-dichloro-3-chlorosulfonylbenzoate. InChIKey: JLQOWNUEIITJGV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Cl3O4S
Molecular weight303.5 g/mol
IUPAC namemethyl 2,5-dichloro-3-chlorosulfonylbenzoate
InChIKeyJLQOWNUEIITJGV-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC(=C1)Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)