CAS 1155910-33-0 is the registry number for Methyl 2,5-dichloro-3-(chlorosulfonyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,5-dichloro-3-chlorosulfonylbenzoate (CAS 1155910-33-0) is a chemical compound with the molecular formula C8H5Cl3O4S and a molecular weight of 303.5 g/mol. IUPAC name: methyl 2,5-dichloro-3-chlorosulfonylbenzoate. InChIKey: JLQOWNUEIITJGV-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O4S |
|---|---|
| Molecular weight | 303.5 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-chlorosulfonylbenzoate |
| InChIKey | JLQOWNUEIITJGV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)