Products 1156316-45-8
CAS 1156316-45-8 is the registry number for 2-(((1H-Pyrazol-3-yl)methyl)amino)-6-fluorobenzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-6-(1H-pyrazol-5-ylmethylamino)benzonitrile (CAS 1156316-45-8) is a chemical compound with the molecular formula C11H9FN4 and a molecular weight of 216.21 g/mol. IUPAC name: 2-fluoro-6-(1H-pyrazol-5-ylmethylamino)benzonitrile. InChIKey: ZUNGZCLOBWBESM-UHFFFAOYSA-N.
| Molecular formula | C11H9FN4 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 2-fluoro-6-(1H-pyrazol-5-ylmethylamino)benzonitrile |
| InChIKey | ZUNGZCLOBWBESM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C#N)NCC2=CC=NN2 |
Computed by PubChem (NCBI)