CAS 1156584-54-1 is the registry number for 2-(3,4-Difluorophenyl)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(3,4-difluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 1156584-54-1) is a chemical compound with the molecular formula C10H5F2NO2S and a molecular weight of 241.22 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: GBWFVHNWUPDSPM-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO2S |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | GBWFVHNWUPDSPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC(=CS2)C(=O)O)F)F |
Computed by PubChem (NCBI)