Products 1156645-45-2
CAS 1156645-45-2 is the registry number for N-(2-Methyl-3-nitrobenzyl)propan-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(2-methyl-3-nitrophenyl)methyl]propan-2-amine (CAS 1156645-45-2) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: N-[(2-methyl-3-nitrophenyl)methyl]propan-2-amine. InChIKey: IEQQNXDSKPNNDJ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-[(2-methyl-3-nitrophenyl)methyl]propan-2-amine |
| InChIKey | IEQQNXDSKPNNDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])CNC(C)C |
Computed by PubChem (NCBI)