CAS 1156719-22-0 appears in our catalog under these names: 3-((2,2,3,3-Tetrafluoropropoxy)methyl)benzene-1-sulfonyl chloride, 95%, 3-((2,2,3,3-Tetrafluoropropoxy)methyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(2,2,3,3-tetrafluoropropoxymethyl)benzenesulfonyl chloride (CAS 1156719-22-0) is a chemical compound with the molecular formula C10H9ClF4O3S and a molecular weight of 320.69 g/mol. IUPAC name: 3-(2,2,3,3-tetrafluoropropoxymethyl)benzenesulfonyl chloride. InChIKey: ZQUHKCPCZCQTAB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF4O3S |
|---|---|
| Molecular weight | 320.69 g/mol |
| IUPAC name | 3-(2,2,3,3-tetrafluoropropoxymethyl)benzenesulfonyl chloride |
| InChIKey | ZQUHKCPCZCQTAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)COCC(C(F)F)(F)F |
Computed by PubChem (NCBI)