CAS 1156977-76-2 is the registry number for Potassium 2-{3-oxo-2H,3H-(1,2,4)triazolo(4,3-a)pyridin-2-yl}acetate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Potassium 2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetate (CAS 1156977-76-2) is a chemical compound with the molecular formula C8H6KN3O3 and a molecular weight of 231.25 g/mol. IUPAC name: potassium 2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetate. InChIKey: CTMTYCWZAZRBSC-UHFFFAOYSA-M.
| Molecular formula | C8H6KN3O3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | potassium 2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetate |
| InChIKey | CTMTYCWZAZRBSC-UHFFFAOYSA-M |
| SMILES | C1=CC2=NN(C(=O)N2C=C1)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)