CAS 1156999-03-9 is the registry number for 1-(3-Bromophenyl)-6-methyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-bromophenyl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1156999-03-9) is a chemical compound with the molecular formula C12H9BrN4O and a molecular weight of 305.13 g/mol. IUPAC name: 1-(3-bromophenyl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: OQCYRTXMSZFCPA-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN4O |
|---|---|
| Molecular weight | 305.13 g/mol |
| IUPAC name | 1-(3-bromophenyl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | OQCYRTXMSZFCPA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C3=CC(=CC=C3)Br)C(=O)N1 |
Computed by PubChem (NCBI)