CAS 1157-74-0 appears in our catalog under these names: Nicorandil Impurity 9, Nicorandil Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-nitrooxyethyl(pyridine-3-carbonyl)amino]ethyl nitrate (CAS 1157-74-0) is a chemical compound with the molecular formula C10H12N4O7 and a molecular weight of 300.22 g/mol. IUPAC name: 2-[2-nitrooxyethyl(pyridine-3-carbonyl)amino]ethyl nitrate. InChIKey: DTOZFZYZIOGHBQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O7 |
|---|---|
| Molecular weight | 300.22 g/mol |
| IUPAC name | 2-[2-nitrooxyethyl(pyridine-3-carbonyl)amino]ethyl nitrate |
| InChIKey | DTOZFZYZIOGHBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)N(CCO[N+](=O)[O-])CCO[N+](=O)[O-] |
Computed by PubChem (NCBI)