CAS 1157079-54-3 appears in our catalog under these names: 3-(3-Bromopropyl)-5-nitro-2,3-dihydro-1,3-benzoxazol-2-one, 3-(3-Bromopropyl)-5-nitro-2,3-dihydro-1,3-benzoxazol-2-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
3-(3-bromopropyl)-5-nitro-1,3-benzoxazol-2-one (CAS 1157079-54-3) is a chemical compound with the molecular formula C10H9BrN2O4 and a molecular weight of 301.09 g/mol. IUPAC name: 3-(3-bromopropyl)-5-nitro-1,3-benzoxazol-2-one. InChIKey: CSWZOAHKUYSXRZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O4 |
|---|---|
| Molecular weight | 301.09 g/mol |
| IUPAC name | 3-(3-bromopropyl)-5-nitro-1,3-benzoxazol-2-one |
| InChIKey | CSWZOAHKUYSXRZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N(C(=O)O2)CCCBr |
Computed by PubChem (NCBI)