Products 1157088-52-2

CAS 1157088-52-2 is the registry number for 6-Bromo-8-chloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

6-bromo-8-chloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 1157088-52-2) is a chemical compound with the molecular formula C10H5BrClNO3 and a molecular weight of 302.51 g/mol. IUPAC name: 6-bromo-8-chloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: VTXZXRBQSDVNCD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5BrClNO3
Molecular weight302.51 g/mol
IUPAC name6-bromo-8-chloro-4-oxo-1H-quinoline-3-carboxylic acid
InChIKeyVTXZXRBQSDVNCD-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1C(=O)C(=CN2)C(=O)O)Cl)Br

Computed by PubChem (NCBI)