CAS 1157095-14-1 is the registry number for N-(Cyclobutylmethyl)-1,3-dimethyl-4-nitro-1H-pyrazol-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(cyclobutylmethyl)-1,3-dimethyl-4-nitropyrazol-5-amine (CAS 1157095-14-1) is a chemical compound with the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. IUPAC name: N-(cyclobutylmethyl)-1,3-dimethyl-4-nitropyrazol-5-amine. InChIKey: LBBVZZBUFRNKQS-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O2 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | N-(cyclobutylmethyl)-1,3-dimethyl-4-nitropyrazol-5-amine |
| InChIKey | LBBVZZBUFRNKQS-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])NCC2CCC2)C |
Computed by PubChem (NCBI)